CAS 1415566-32-3 appears in our catalog under these names: (2R)-1-[(tert-Butoxy)carbonyl]-2-methylpiperidine-2-carboxylic acid, 95%, (R)-1-(tert-Butoxycarbonyl)-2-methylpiperidine-2-carboxylic acid, 98%, (R)-1-(tert-butoxycarbonyl)-2-methylpiperidine-2-carboxylic acid, 97%, 97%, (R)-1-(tert-Butoxycarbonyl)-2-methylpiperidine-2-carboxylic acid, 99.19%. Offered by: Combi-blocks, AmBeed, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 1g, 100mg, 5g, 250mg, 10g, 500mg, 50 mg, 10 mg.
(2R)-2-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-2-carboxylic acid (CAS 1415566-32-3) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: (2R)-2-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-2-carboxylic acid. InChIKey: BDAXXVZMKUJADB-GFCCVEGCSA-N.
| Molecular formula | C12H21NO4 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | (2R)-2-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-2-carboxylic acid |
| InChIKey | BDAXXVZMKUJADB-GFCCVEGCSA-N |
| SMILES | C[C@@]1(CCCCN1C(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)