CAS 534602-47-6 appears in our catalog under these names: N-Boc-3-methylpiperidine-3-carboxylic Acid, 1-(tert-Butoxycarbonyl)-3-methylpiperidine-3-carboxylic acid, 97%, 97%, 1-Boc-3-methylpipecolinic acid, 97%. Offered by: TRC, Chemat, Fluorochem. Available pack sizes: 1g, 500mg, 5g, 250mg, 25g.
3-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-3-carboxylic acid (CAS 534602-47-6) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: 3-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-3-carboxylic acid. InChIKey: LNQIKLOOSITZGB-UHFFFAOYSA-N.
| Molecular formula | C12H21NO4 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | 3-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-3-carboxylic acid |
| InChIKey | LNQIKLOOSITZGB-UHFFFAOYSA-N |
| SMILES | CC1(CCCN(C1)C(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)