CAS 1415018-76-6 appears in our catalog under these names: (S)-1-(tert-Butoxycarbonyl)-3-methylpiperidine-3-carboxylic acid 95%, (3R)-1-[(tert-Butoxy)carbonyl]-3-methylpiperidine-3-carboxylic acid, 95%, 95%, (S)-1-(TERT-BUTOXYCARBONYL)-3-METHYLPIPERIDINE-3-CARBOXYLIC ACID, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 500mg.
(3S)-3-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-3-carboxylic acid (CAS 1415018-76-6) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: (3S)-3-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-3-carboxylic acid. InChIKey: LNQIKLOOSITZGB-LBPRGKRZSA-N.
| Molecular formula | C12H21NO4 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | (3S)-3-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-3-carboxylic acid |
| InChIKey | LNQIKLOOSITZGB-LBPRGKRZSA-N |
| SMILES | C[C@@]1(CCCN(C1)C(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)