cas: 130636-61-2 — see every product listed under this CAS number, including other names
1-Boc-4-(4-Nitrobenzyl)piperazine, 98%, 98% (CAS 130636-61-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111UQL-100mg |
| cas | 130636-61-2 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 170.00 Pln | |
| Chemat | 5g | 496.40 Pln | |
| Chemat | 10g | 909.20 Pln | |
| Chemat | 25g | 1922.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 4-[(4-nitrophenyl)methyl]piperazine-1-carboxylate (CAS 130636-61-2) is a chemical compound with the molecular formula C16H23N3O4 and a molecular weight of 321.37 g/mol. IUPAC name: tert-butyl 4-[(4-nitrophenyl)methyl]piperazine-1-carboxylate. InChIKey: XWWBHMXIEAVTGS-UHFFFAOYSA-N.
| Molecular formula | C16H23N3O4 |
|---|---|
| Molecular weight | 321.37 g/mol |
| IUPAC name | tert-butyl 4-[(4-nitrophenyl)methyl]piperazine-1-carboxylate |
| InChIKey | XWWBHMXIEAVTGS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)CC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)