CAS 197237-15-3 is the registry number for L-Norvalinamide, n-[(phenylmethoxy)carbonyl]-l-alanyl-, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 500mg.
Benzyl N-[(2S)-1-[[(2S)-1-amino-1-oxopentan-2-yl]amino]-1-oxopropan-2-yl]carbamate (CAS 197237-15-3) is a chemical compound with the molecular formula C16H23N3O4 and a molecular weight of 321.37 g/mol. IUPAC name: benzyl N-[(2S)-1-[[(2S)-1-amino-1-oxopentan-2-yl]amino]-1-oxopropan-2-yl]carbamate. InChIKey: NBLGPPBCDDOBNI-AAEUAGOBSA-N.
| Molecular formula | C16H23N3O4 |
|---|---|
| Molecular weight | 321.37 g/mol |
| IUPAC name | benzyl N-[(2S)-1-[[(2S)-1-amino-1-oxopentan-2-yl]amino]-1-oxopropan-2-yl]carbamate |
| InChIKey | NBLGPPBCDDOBNI-AAEUAGOBSA-N |
| SMILES | CCC[C@@H](C(=O)N)NC(=O)[C@H](C)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)