CAS 863401-75-6 is the registry number for Methyl-[1-(4-nitro-phenyl)-pyrrolidin-3-yl]-carbamic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Tert-butyl N-methyl-N-[1-(4-nitrophenyl)pyrrolidin-3-yl]carbamate (CAS 863401-75-6) is a chemical compound with the molecular formula C16H23N3O4 and a molecular weight of 321.37 g/mol. IUPAC name: tert-butyl N-methyl-N-[1-(4-nitrophenyl)pyrrolidin-3-yl]carbamate. InChIKey: MQOJFWUJXJPYDP-UHFFFAOYSA-N.
| Molecular formula | C16H23N3O4 |
|---|---|
| Molecular weight | 321.37 g/mol |
| IUPAC name | tert-butyl N-methyl-N-[1-(4-nitrophenyl)pyrrolidin-3-yl]carbamate |
| InChIKey | MQOJFWUJXJPYDP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C)C1CCN(C1)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)