Products 863401-75-6

CAS 863401-75-6 is the registry number for Methyl-[1-(4-nitro-phenyl)-pyrrolidin-3-yl]-carbamic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

Tert-butyl N-methyl-N-[1-(4-nitrophenyl)pyrrolidin-3-yl]carbamate (CAS 863401-75-6) is a chemical compound with the molecular formula C16H23N3O4 and a molecular weight of 321.37 g/mol. IUPAC name: tert-butyl N-methyl-N-[1-(4-nitrophenyl)pyrrolidin-3-yl]carbamate. InChIKey: MQOJFWUJXJPYDP-UHFFFAOYSA-N.

Identity
Molecular formulaC16H23N3O4
Molecular weight321.37 g/mol
IUPAC nametert-butyl N-methyl-N-[1-(4-nitrophenyl)pyrrolidin-3-yl]carbamate
InChIKeyMQOJFWUJXJPYDP-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N(C)C1CCN(C1)C2=CC=C(C=C2)[N+](=O)[O-]

Computed by PubChem (NCBI)