Products 361345-36-0
CAS 361345-36-0 is the registry number for tert-Butyl 4-(2-methyl-4-nitrophenyl)piperazine-1-carboxylate, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Tert-butyl 4-(2-methyl-4-nitrophenyl)piperazine-1-carboxylate (CAS 361345-36-0) is a chemical compound with the molecular formula C16H23N3O4 and a molecular weight of 321.37 g/mol. IUPAC name: tert-butyl 4-(2-methyl-4-nitrophenyl)piperazine-1-carboxylate. InChIKey: MNAAPQLWAKMBFX-UHFFFAOYSA-N.
| Molecular formula | C16H23N3O4 |
|---|---|
| Molecular weight | 321.37 g/mol |
| IUPAC name | tert-butyl 4-(2-methyl-4-nitrophenyl)piperazine-1-carboxylate |
| InChIKey | MNAAPQLWAKMBFX-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)[N+](=O)[O-])N2CCN(CC2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)