cas: 199003-22-0 — see every product listed under this CAS number, including other names
1-Boc-4-(hydroxymethyl)pyrazole 97% (CAS 199003-22-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A561822-100mg |
| cas | 199003-22-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 170.12 Pln | |
| Ambeed | 250mg | 214.62 Pln | |
| Ambeed | 1g | 375.94 Pln | |
| Ambeed | 5g | 1126.88 Pln | |
| Ambeed | 10g | 2178.19 Pln | |
| Ambeed | 25g | 3763.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A561822 |
Tert-butyl 4-(hydroxymethyl)pyrazole-1-carboxylate (CAS 199003-22-0) is a chemical compound with the molecular formula C9H14N2O3 and a molecular weight of 198.22 g/mol. IUPAC name: tert-butyl 4-(hydroxymethyl)pyrazole-1-carboxylate. InChIKey: CIPRBVVWJSJWBE-UHFFFAOYSA-N.
| Molecular formula | C9H14N2O3 |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | tert-butyl 4-(hydroxymethyl)pyrazole-1-carboxylate |
| InChIKey | CIPRBVVWJSJWBE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=C(C=N1)CO |
Computed by PubChem (NCBI)