cas: 908140-15-8 — see every product listed under this CAS number, including other names
1-Boc-4-cyano-4-hydroxypiperidine, 97%, 97% (CAS 908140-15-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch117A7A-100mg |
| cas | 908140-15-8 |
| size | 100mg |
| availability | 21g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 189.20 Pln | |
| Chemat | 250mg | 294.80 Pln | |
| Chemat | 1g | 496.40 Pln | |
| Chemat | 5g | 1523.60 Pln | |
| Chemat | 10g | 2502.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 4-cyano-4-hydroxypiperidine-1-carboxylate (CAS 908140-15-8) is a chemical compound with the molecular formula C11H18N2O3 and a molecular weight of 226.27 g/mol. IUPAC name: tert-butyl 4-cyano-4-hydroxypiperidine-1-carboxylate. InChIKey: WWAGFFFOCPKWFA-UHFFFAOYSA-N.
| Molecular formula | C11H18N2O3 |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | tert-butyl 4-cyano-4-hydroxypiperidine-1-carboxylate |
| InChIKey | WWAGFFFOCPKWFA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)(C#N)O |
Computed by PubChem (NCBI)