Products 2270905-47-8
CAS 2270905-47-8 is the registry number for 2-(4-Isobutoxy-pyrazol-1-yl)-2-methyl-propionic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-methyl-2-[4-(2-methylpropoxy)pyrazol-1-yl]propanoic acid (CAS 2270905-47-8) is a chemical compound with the molecular formula C11H18N2O3 and a molecular weight of 226.27 g/mol. IUPAC name: 2-methyl-2-[4-(2-methylpropoxy)pyrazol-1-yl]propanoic acid. InChIKey: NZTKQNXOQLITSA-UHFFFAOYSA-N.
| Molecular formula | C11H18N2O3 |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | 2-methyl-2-[4-(2-methylpropoxy)pyrazol-1-yl]propanoic acid |
| InChIKey | NZTKQNXOQLITSA-UHFFFAOYSA-N |
| SMILES | CC(C)COC1=CN(N=C1)C(C)(C)C(=O)O |
Computed by PubChem (NCBI)