CAS 2365420-19-3 appears in our catalog under these names: tert-Butyl 2-(5-isopropyl-1,2,4-oxadiazol-3-yl)acetate, 96%, tert-Butyl 2-(5-isopropyl-1,2,4-oxadiazol-3-yl)acetate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g, 10g.
Tert-butyl 2-(5-propan-2-yl-1,2,4-oxadiazol-3-yl)acetate (CAS 2365420-19-3) is a chemical compound with the molecular formula C11H18N2O3 and a molecular weight of 226.27 g/mol. IUPAC name: tert-butyl 2-(5-propan-2-yl-1,2,4-oxadiazol-3-yl)acetate. InChIKey: RNDLVNYRNCSACB-UHFFFAOYSA-N.
| Molecular formula | C11H18N2O3 |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | tert-butyl 2-(5-propan-2-yl-1,2,4-oxadiazol-3-yl)acetate |
| InChIKey | RNDLVNYRNCSACB-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NC(=NO1)CC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)