CAS 2270905-06-9 is the registry number for (4-Hydroxy-3,5-dimethyl-pyrazol-1-yl)-acetic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Tert-butyl 2-(4-hydroxy-3,5-dimethylpyrazol-1-yl)acetate (CAS 2270905-06-9) is a chemical compound with the molecular formula C11H18N2O3 and a molecular weight of 226.27 g/mol. IUPAC name: tert-butyl 2-(4-hydroxy-3,5-dimethylpyrazol-1-yl)acetate. InChIKey: AYJPNMRVZZPYEX-UHFFFAOYSA-N.
| Molecular formula | C11H18N2O3 |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | tert-butyl 2-(4-hydroxy-3,5-dimethylpyrazol-1-yl)acetate |
| InChIKey | AYJPNMRVZZPYEX-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1CC(=O)OC(C)(C)C)C)O |
Computed by PubChem (NCBI)