Products 75400-67-8
CAS 75400-67-8 appears in our catalog under these names: 1-Boc-indole, 97% , tert-Butyl 1H-Indole-1-carboxylate, >95.0%(HPLC)(qNMR), 1-Boc-indole 98%, tert-Butyl 1-indolecarboxylate, 98%, 98%, TERT-BUTYL 1H-INDOLE-1-CARBOXYLATE, 95%. Offered by: Thermo Scientific (Alfa Aesar), TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g, 100g.
Tert-butyl indole-1-carboxylate (CAS 75400-67-8) is a chemical compound with the molecular formula C13H15NO2 and a molecular weight of 217.26 g/mol. IUPAC name: tert-butyl indole-1-carboxylate. InChIKey: OWPIFQXNMLDXKW-UHFFFAOYSA-N.
| Molecular formula | C13H15NO2 |
|---|---|
| Molecular weight | 217.26 g/mol |
| IUPAC name | tert-butyl indole-1-carboxylate |
| InChIKey | OWPIFQXNMLDXKW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=CC2=CC=CC=C21 |
Computed by PubChem (NCBI)