cas: 187834-88-4 — see every product listed under this CAS number, including other names
1-Boc-isonipecoticacidhydrazide 97% (CAS 187834-88-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A133588-250mg |
| cas | 187834-88-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 125.62 Pln | |
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 259.12 Pln | |
| Ambeed | 10g | 414.88 Pln | |
| Ambeed | 25g | 876.56 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A133588 |
Tert-butyl 4-(hydrazinecarbonyl)piperidine-1-carboxylate (CAS 187834-88-4) is a chemical compound with the molecular formula C11H21N3O3 and a molecular weight of 243.30 g/mol. IUPAC name: tert-butyl 4-(hydrazinecarbonyl)piperidine-1-carboxylate. InChIKey: JLIKTOWFNQDEME-UHFFFAOYSA-N.
| Molecular formula | C11H21N3O3 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | tert-butyl 4-(hydrazinecarbonyl)piperidine-1-carboxylate |
| InChIKey | JLIKTOWFNQDEME-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)C(=O)NN |
Computed by PubChem (NCBI)