cas: 127168-82-5 — see every product listed under this CAS number, including other names
1-Bromo-2,3-bis(bromomethyl)benzene, 98% (CAS 127168-82-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F322824-100MG |
| cas | 127168-82-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 581.06 Pln | |
| Fluorochem | 250mg | 924.69 Pln | |
| Fluorochem | 1g | 1096.51 Pln | |
| Fluorochem | 5g | 3184.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1-bromo-2,3-bis(bromomethyl)benzene (CAS 127168-82-5) is a chemical compound with the molecular formula C8H7Br3 and a molecular weight of 342.85 g/mol. IUPAC name: 1-bromo-2,3-bis(bromomethyl)benzene. InChIKey: ASZRHSLOVXUBHJ-UHFFFAOYSA-N.
| Molecular formula | C8H7Br3 |
|---|---|
| Molecular weight | 342.85 g/mol |
| IUPAC name | 1-bromo-2,3-bis(bromomethyl)benzene |
| InChIKey | ASZRHSLOVXUBHJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)CBr)CBr |
Computed by PubChem (NCBI)