CAS 53170-87-9 is the registry number for 1,2,3-tribromo-4,5-dimethylbenzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1,2,3-tribromo-4,5-dimethylbenzene (CAS 53170-87-9) is a chemical compound with the molecular formula C8H7Br3 and a molecular weight of 342.85 g/mol. IUPAC name: 1,2,3-tribromo-4,5-dimethylbenzene. InChIKey: VEHXGFFOMROPFY-UHFFFAOYSA-N.
| Molecular formula | C8H7Br3 |
|---|---|
| Molecular weight | 342.85 g/mol |
| IUPAC name | 1,2,3-tribromo-4,5-dimethylbenzene |
| InChIKey | VEHXGFFOMROPFY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1C)Br)Br)Br |
Computed by PubChem (NCBI)