CAS 2310221-35-1 is the registry number for 1,2,3-Tribromo-5-ethylbenzene, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
1,2,3-tribromo-5-ethylbenzene (CAS 2310221-35-1) is a chemical compound with the molecular formula C8H7Br3 and a molecular weight of 342.85 g/mol. IUPAC name: 1,2,3-tribromo-5-ethylbenzene. InChIKey: ZWQZQLNCSBKQQB-UHFFFAOYSA-N.
| Molecular formula | C8H7Br3 |
|---|---|
| Molecular weight | 342.85 g/mol |
| IUPAC name | 1,2,3-tribromo-5-ethylbenzene |
| InChIKey | ZWQZQLNCSBKQQB-UHFFFAOYSA-N |
| SMILES | CCC1=CC(=C(C(=C1)Br)Br)Br |
Computed by PubChem (NCBI)