Products 33458-10-5

CAS 33458-10-5 is the registry number for 1-Bromo-4-(1,2-dibromoethyl)benzene, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g, 100g.

Structural formula: {0} (CAS {1})

1-bromo-4-(1,2-dibromoethyl)benzene (CAS 33458-10-5) is a chemical compound with the molecular formula C8H7Br3 and a molecular weight of 342.85 g/mol. IUPAC name: 1-bromo-4-(1,2-dibromoethyl)benzene. InChIKey: NRUIEVHCKHZAHT-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7Br3
Molecular weight342.85 g/mol
IUPAC name1-bromo-4-(1,2-dibromoethyl)benzene
InChIKeyNRUIEVHCKHZAHT-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C(CBr)Br)Br

Computed by PubChem (NCBI)