cas: 1417569-62-0 — see every product listed under this CAS number, including other names
1-Bromo-2,3-difluoro-4-(trifluoromethoxy)benzene, 95%,RG, 95%,RG (CAS 1417569-62-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112GZK-100mg |
| cas | 1417569-62-0 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 554.00 Pln | |
| Chemat | 250mg | 918.80 Pln | |
| Chemat | 1g | 2800.40 Pln |
| purity | 95%,RG |
|---|---|
| delivery time | 3 weeks |
1-bromo-2,3-difluoro-4-(trifluoromethoxy)benzene (CAS 1417569-62-0) is a chemical compound with the molecular formula C7H2BrF5O and a molecular weight of 276.99 g/mol. IUPAC name: 1-bromo-2,3-difluoro-4-(trifluoromethoxy)benzene. InChIKey: STZVSTCFPFXRII-UHFFFAOYSA-N.
| Molecular formula | C7H2BrF5O |
|---|---|
| Molecular weight | 276.99 g/mol |
| IUPAC name | 1-bromo-2,3-difluoro-4-(trifluoromethoxy)benzene |
| InChIKey | STZVSTCFPFXRII-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1OC(F)(F)F)F)F)Br |
Computed by PubChem (NCBI)