Products 1807187-83-2
CAS 1807187-83-2 appears in our catalog under these names: 2,4-Difluoro-3-(trifluoromethoxy)bromobenzene, 95%, 2,4-Difluoro-3-(trifluoromethoxy)bromobenzene. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 0,5g, 50mg.
1-bromo-2,4-difluoro-3-(trifluoromethoxy)benzene (CAS 1807187-83-2) is a chemical compound with the molecular formula C7H2BrF5O and a molecular weight of 276.99 g/mol. IUPAC name: 1-bromo-2,4-difluoro-3-(trifluoromethoxy)benzene. InChIKey: WDVASDORAKSUSV-UHFFFAOYSA-N.
| Molecular formula | C7H2BrF5O |
|---|---|
| Molecular weight | 276.99 g/mol |
| IUPAC name | 1-bromo-2,4-difluoro-3-(trifluoromethoxy)benzene |
| InChIKey | WDVASDORAKSUSV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)OC(F)(F)F)F)Br |
Computed by PubChem (NCBI)