cas: 1417569-62-0 — see every product listed under this CAS number, including other names
1-Bromo-2,3-difluoro-4-(trifluoromethoxy)benzene, 95+% (CAS 1417569-62-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A683198-5g |
| cas | 1417569-62-0 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 15303.40 Pln | |
| AmBeed | 1g | 4047.61 Pln | |
| AmBeed | 10g | 19111.75 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
1-bromo-2,3-difluoro-4-(trifluoromethoxy)benzene (CAS 1417569-62-0) is a chemical compound with the molecular formula C7H2BrF5O and a molecular weight of 276.99 g/mol. IUPAC name: 1-bromo-2,3-difluoro-4-(trifluoromethoxy)benzene. InChIKey: STZVSTCFPFXRII-UHFFFAOYSA-N.
| Molecular formula | C7H2BrF5O |
|---|---|
| Molecular weight | 276.99 g/mol |
| IUPAC name | 1-bromo-2,3-difluoro-4-(trifluoromethoxy)benzene |
| InChIKey | STZVSTCFPFXRII-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1OC(F)(F)F)F)F)Br |
Computed by PubChem (NCBI)