CAS 1807078-27-8 is the registry number for 1-Bromo-3,6-difluoro-2-(trifluoromethoxy)benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
2-bromo-1,4-difluoro-3-(trifluoromethoxy)benzene (CAS 1807078-27-8) is a chemical compound with the molecular formula C7H2BrF5O and a molecular weight of 276.99 g/mol. IUPAC name: 2-bromo-1,4-difluoro-3-(trifluoromethoxy)benzene. InChIKey: UYOCYKNSAQMZHG-UHFFFAOYSA-N.
| Molecular formula | C7H2BrF5O |
|---|---|
| Molecular weight | 276.99 g/mol |
| IUPAC name | 2-bromo-1,4-difluoro-3-(trifluoromethoxy)benzene |
| InChIKey | UYOCYKNSAQMZHG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)OC(F)(F)F)Br)F |
Computed by PubChem (NCBI)