cas: 1268816-55-2 — see every product listed under this CAS number, including other names
1-Bromo-2-chloro-5-methyl-4-nitrobenzene, 98%, 98% (CAS 1268816-55-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111TF9-100mg |
| cas | 1268816-55-2 |
| size | 100mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 112.40 Pln | |
| Chemat | 500mg | 146.00 Pln | |
| Chemat | 1g | 179.60 Pln | |
| Chemat | 5g | 405.20 Pln | |
| Chemat | 10g | 717.20 Pln | |
| Chemat | 25g | 1302.80 Pln | |
| Chemat | 100g | 3851.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-bromo-2-chloro-5-methyl-4-nitrobenzene (CAS 1268816-55-2) is a chemical compound with the molecular formula C7H5BrClNO2 and a molecular weight of 250.48 g/mol. IUPAC name: 1-bromo-2-chloro-5-methyl-4-nitrobenzene. InChIKey: TZHVMSQOHKXEFX-UHFFFAOYSA-N.
| Molecular formula | C7H5BrClNO2 |
|---|---|
| Molecular weight | 250.48 g/mol |
| IUPAC name | 1-bromo-2-chloro-5-methyl-4-nitrobenzene |
| InChIKey | TZHVMSQOHKXEFX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1[N+](=O)[O-])Cl)Br |
Computed by PubChem (NCBI)