CAS 3030-19-1 appears in our catalog under these names: 6-Amino-3-bromo-2-chlorobenzoic acid, 95%, 6-Amino-3-bromo-2-chlorobenzoic acid, 98%, 98%, 6-Amino-3-bromo-2-chlorobenzoic acid, 6-Amino-3-bromo-2-chlorobenzoic acid, 97%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 100mg, 5g.
6-amino-3-bromo-2-chlorobenzoic acid (CAS 3030-19-1) is a chemical compound with the molecular formula C7H5BrClNO2 and a molecular weight of 250.48 g/mol. IUPAC name: 6-amino-3-bromo-2-chlorobenzoic acid. InChIKey: AQQXRSNOIQEAMM-UHFFFAOYSA-N.
| Molecular formula | C7H5BrClNO2 |
|---|---|
| Molecular weight | 250.48 g/mol |
| IUPAC name | 6-amino-3-bromo-2-chlorobenzoic acid |
| InChIKey | AQQXRSNOIQEAMM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1N)C(=O)O)Cl)Br |
Computed by PubChem (NCBI)