CAS 55289-35-5 appears in our catalog under these names: 2–Bromo–6–nitrotoluene, 2-Bromo-6-nitrotoluene, 98% , 2-Bromo-6-nitrotoluene, 2-Bromo-6-nitrotoluene, 98%, 2-Bromo-6-nitrotoluene, >98.0%(GC). Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, Thermo Scientific (Acros), TCI. Available pack sizes: 100g, 25g, 5g, 10g, 50g, 1000g, 1g, 500g.
1-bromo-2-methyl-3-nitrobenzene (CAS 55289-35-5) is a chemical compound with the molecular formula C7H6BrNO2 and a molecular weight of 216.03 g/mol. IUPAC name: 1-bromo-2-methyl-3-nitrobenzene. InChIKey: LYTNSGFSAXWBCA-UHFFFAOYSA-N.
| Molecular formula | C7H6BrNO2 |
|---|---|
| Molecular weight | 216.03 g/mol |
| IUPAC name | 1-bromo-2-methyl-3-nitrobenzene |
| InChIKey | LYTNSGFSAXWBCA-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC=C1Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)