CAS 3958-57-4 appears in our catalog under these names: 3-Nitrobenzyl bromide, 95%, 1-(Bromomethyl)-3-nitrobenzene, 98%, Rizatriptan Impurity 8, 3–Nitrobenzyl bromide, 3-Nitrobenzyl bromide/ 98+%. Offered by: Combi-blocks, Chemat Brand, GLPBio, Chemat, Thermo Scientific (Alfa Aesar). Available pack sizes: 25g, 5g, 1g, 100g, on request, 10g, 0,5kg, 1kg.
1-(bromomethyl)-3-nitrobenzene (CAS 3958-57-4) is a chemical compound with the molecular formula C7H6BrNO2 and a molecular weight of 216.03 g/mol. IUPAC name: 1-(bromomethyl)-3-nitrobenzene. InChIKey: LNWXALCHPJANMJ-UHFFFAOYSA-N.
| Molecular formula | C7H6BrNO2 |
|---|---|
| Molecular weight | 216.03 g/mol |
| IUPAC name | 1-(bromomethyl)-3-nitrobenzene |
| InChIKey | LNWXALCHPJANMJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])CBr |
Computed by PubChem (NCBI)