CAS 401811-78-7 appears in our catalog under these names: 5-Bromo-1,3-benzodioxol-4-amine, 95%, 5-Bromobenzo(d)(1,3)dioxol-4-amine, 98%, 5-Bromobenzo[d][1,3]dioxol-4-amine, 96%, 96%, 5-BROMO-1,3-BENZODIOXOL-4-AMINE, 96%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 10g, 5g, 100mg.
5-bromo-1,3-benzodioxol-4-amine (CAS 401811-78-7) is a chemical compound with the molecular formula C7H6BrNO2 and a molecular weight of 216.03 g/mol. IUPAC name: 5-bromo-1,3-benzodioxol-4-amine. InChIKey: LQAZIDHOTLRDSD-UHFFFAOYSA-N.
| Molecular formula | C7H6BrNO2 |
|---|---|
| Molecular weight | 216.03 g/mol |
| IUPAC name | 5-bromo-1,3-benzodioxol-4-amine |
| InChIKey | LQAZIDHOTLRDSD-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C(=C(C=C2)Br)N |
Computed by PubChem (NCBI)