CAS 28177-82-4 is the registry number for 3-Bromo-2-hydroxybenzaldehyde oxime, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 100g, 5g, 1g.
2-bromo-6-[(E)-hydroxyiminomethyl]phenol (CAS 28177-82-4) is a chemical compound with the molecular formula C7H6BrNO2 and a molecular weight of 216.03 g/mol. IUPAC name: 2-bromo-6-[(E)-hydroxyiminomethyl]phenol. InChIKey: WUMOCQYUOSVORL-RUDMXATFSA-N.
| Molecular formula | C7H6BrNO2 |
|---|---|
| Molecular weight | 216.03 g/mol |
| IUPAC name | 2-bromo-6-[(E)-hydroxyiminomethyl]phenol |
| InChIKey | WUMOCQYUOSVORL-RUDMXATFSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)O)/C=N/O |
Computed by PubChem (NCBI)