cas: 70399-01-8 — see every product listed under this CAS number, including other names
1-Bromo-3-(isopropylsulfonyl)benzene, 96% (CAS 70399-01-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F217226-250MG |
| cas | 70399-01-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 133.30 Pln | |
| Fluorochem | 1g | 164.54 Pln | |
| Fluorochem | 5g | 570.65 Pln | |
| Fluorochem | 10g | 1080.89 Pln | |
| Fluorochem | 25g | 2330.45 Pln | |
| Fluorochem | 100g | 9156.17 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
1-bromo-3-propan-2-ylsulfonylbenzene (CAS 70399-01-8) is a chemical compound with the molecular formula C9H11BrO2S and a molecular weight of 263.15 g/mol. IUPAC name: 1-bromo-3-propan-2-ylsulfonylbenzene. InChIKey: XPYUPOJVBBWILU-UHFFFAOYSA-N.
| Molecular formula | C9H11BrO2S |
|---|---|
| Molecular weight | 263.15 g/mol |
| IUPAC name | 1-bromo-3-propan-2-ylsulfonylbenzene |
| InChIKey | XPYUPOJVBBWILU-UHFFFAOYSA-N |
| SMILES | CC(C)S(=O)(=O)C1=CC(=CC=C1)Br |
Computed by PubChem (NCBI)