CAS 33451-05-7 appears in our catalog under these names: (3-Bromopropanesulfonyl)benzene, 95%, ((3-Bromopropyl)sulfonyl)benzene, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
3-bromopropylsulfonylbenzene (CAS 33451-05-7) is a chemical compound with the molecular formula C9H11BrO2S and a molecular weight of 263.15 g/mol. IUPAC name: 3-bromopropylsulfonylbenzene. InChIKey: ZJVQVMPTLHGCSC-UHFFFAOYSA-N.
| Molecular formula | C9H11BrO2S |
|---|---|
| Molecular weight | 263.15 g/mol |
| IUPAC name | 3-bromopropylsulfonylbenzene |
| InChIKey | ZJVQVMPTLHGCSC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)CCCBr |
Computed by PubChem (NCBI)