CAS 1354954-34-9 is the registry number for 1-Bromo-2-(propanesulfonyl)benzene, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
1-bromo-2-propylsulfonylbenzene (CAS 1354954-34-9) is a chemical compound with the molecular formula C9H11BrO2S and a molecular weight of 263.15 g/mol. IUPAC name: 1-bromo-2-propylsulfonylbenzene. InChIKey: PETUJBQNXFOBJF-UHFFFAOYSA-N.
| Molecular formula | C9H11BrO2S |
|---|---|
| Molecular weight | 263.15 g/mol |
| IUPAC name | 1-bromo-2-propylsulfonylbenzene |
| InChIKey | PETUJBQNXFOBJF-UHFFFAOYSA-N |
| SMILES | CCCS(=O)(=O)C1=CC=CC=C1Br |
Computed by PubChem (NCBI)