CAS 1864063-77-3 is the registry number for 1-Bromo-4-methanesulfonyl-2,5-dimethylbenzene, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1-bromo-2,5-dimethyl-4-methylsulfonylbenzene (CAS 1864063-77-3) is a chemical compound with the molecular formula C9H11BrO2S and a molecular weight of 263.15 g/mol. IUPAC name: 1-bromo-2,5-dimethyl-4-methylsulfonylbenzene. InChIKey: WVJBRAAANBGVCL-UHFFFAOYSA-N.
| Molecular formula | C9H11BrO2S |
|---|---|
| Molecular weight | 263.15 g/mol |
| IUPAC name | 1-bromo-2,5-dimethyl-4-methylsulfonylbenzene |
| InChIKey | WVJBRAAANBGVCL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1Br)C)S(=O)(=O)C |
Computed by PubChem (NCBI)