cas: 1004112-67-7 — see every product listed under this CAS number, including other names
1-Bromo-3-chloro-5-(difluoromethoxy)benzene, 95% (CAS 1004112-67-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F212210-250MG |
| cas | 1004112-67-7 |
| size | 250mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 143.72 Pln | |
| Fluorochem | 1g | 305.12 Pln | |
| Ambeed | 250mg | 259.12 Pln | |
| Ambeed | 1g | 331.44 Pln | |
| Ambeed | 5g | 948.88 Pln | |
| Chemat | 250mg | 107.60 Pln | |
| Chemat | 1g | 218.00 Pln | |
| Chemat | 5g | 827.60 Pln | |
| BLDpharm | 250mg | 275.48 Pln | |
| BLDpharm | 1g | 347.68 Pln | |
| BLDpharm | 5g | 1019.67 Pln |
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
1-bromo-3-chloro-5-(difluoromethoxy)benzene (CAS 1004112-67-7) is a chemical compound with the molecular formula C7H4BrClF2O and a molecular weight of 257.46 g/mol. IUPAC name: 1-bromo-3-chloro-5-(difluoromethoxy)benzene. InChIKey: IVRGKKXJURVLGX-UHFFFAOYSA-N.
| Molecular formula | C7H4BrClF2O |
|---|---|
| Molecular weight | 257.46 g/mol |
| IUPAC name | 1-bromo-3-chloro-5-(difluoromethoxy)benzene |
| InChIKey | IVRGKKXJURVLGX-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Cl)Br)OC(F)F |
Computed by PubChem (NCBI)