CAS 2121512-37-4 appears in our catalog under these names: 6-Bromo-3-chloro-2,4-difluorobenzyl alcohol, 95%, (6-Bromo-3-chloro-2,4-difluorophenyl)methanol, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
(6-bromo-3-chloro-2,4-difluorophenyl)methanol (CAS 2121512-37-4) is a chemical compound with the molecular formula C7H4BrClF2O and a molecular weight of 257.46 g/mol. IUPAC name: (6-bromo-3-chloro-2,4-difluorophenyl)methanol. InChIKey: KVGSBISFDSEUBP-UHFFFAOYSA-N.
| Molecular formula | C7H4BrClF2O |
|---|---|
| Molecular weight | 257.46 g/mol |
| IUPAC name | (6-bromo-3-chloro-2,4-difluorophenyl)methanol |
| InChIKey | KVGSBISFDSEUBP-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)CO)F)Cl)F |
Computed by PubChem (NCBI)