Products 1000574-90-2
CAS 1000574-90-2 is the registry number for 2-Bromo-1-chloro-4-(difluoromethoxy)benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-bromo-1-chloro-4-(difluoromethoxy)benzene (CAS 1000574-90-2) is a chemical compound with the molecular formula C7H4BrClF2O and a molecular weight of 257.46 g/mol. IUPAC name: 2-bromo-1-chloro-4-(difluoromethoxy)benzene. InChIKey: YPKJIEMJTXQKGI-UHFFFAOYSA-N.
| Molecular formula | C7H4BrClF2O |
|---|---|
| Molecular weight | 257.46 g/mol |
| IUPAC name | 2-bromo-1-chloro-4-(difluoromethoxy)benzene |
| InChIKey | YPKJIEMJTXQKGI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OC(F)F)Br)Cl |
Computed by PubChem (NCBI)