Products 1780209-73-5
CAS 1780209-73-5 is the registry number for 1-Bromo-5-chloro-3,4-difluoro-2-methoxybenzene, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-bromo-5-chloro-3,4-difluoro-2-methoxybenzene (CAS 1780209-73-5) is a chemical compound with the molecular formula C7H4BrClF2O and a molecular weight of 257.46 g/mol. IUPAC name: 1-bromo-5-chloro-3,4-difluoro-2-methoxybenzene. InChIKey: YFPALZDMYFYAFT-UHFFFAOYSA-N.
| Molecular formula | C7H4BrClF2O |
|---|---|
| Molecular weight | 257.46 g/mol |
| IUPAC name | 1-bromo-5-chloro-3,4-difluoro-2-methoxybenzene |
| InChIKey | YFPALZDMYFYAFT-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1F)F)Cl)Br |
Computed by PubChem (NCBI)