cas: 1214345-25-1 — see every product listed under this CAS number, including other names
1-Bromo-3-methoxy-2-(trifluoromethyl)benzene, 97% (CAS 1214345-25-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F450589-250MG |
| cas | 1214345-25-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 107.27 Pln | |
| Fluorochem | 1g | 128.10 Pln | |
| Fluorochem | 5g | 419.66 Pln | |
| Fluorochem | 10g | 789.32 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1-bromo-3-methoxy-2-(trifluoromethyl)benzene (CAS 1214345-25-1) is a chemical compound with the molecular formula C8H6BrF3O and a molecular weight of 255.03 g/mol. IUPAC name: 1-bromo-3-methoxy-2-(trifluoromethyl)benzene. InChIKey: ADCZJLDFAFIEPM-UHFFFAOYSA-N.
| Molecular formula | C8H6BrF3O |
|---|---|
| Molecular weight | 255.03 g/mol |
| IUPAC name | 1-bromo-3-methoxy-2-(trifluoromethyl)benzene |
| InChIKey | ADCZJLDFAFIEPM-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC=C1)Br)C(F)(F)F |
Computed by PubChem (NCBI)