CAS 198649-68-2 appears in our catalog under these names: 2–(Trifluoromethoxy)benzyl bromide, 2-(Trifluoromethoxy)benzyl bromide, 2-(Trifluoromethoxy)benzyl bromide, 98%, 2-(Trifluoromethoxy)benzyl bromide, 95%, 2-(Trifluoromethoxy)benzyl Bromide, >98.0%(GC). Offered by: GLPBio, Biosynth, Combi-blocks, Fluorochem, TCI. Available pack sizes: 100g, 25g, 5g, 500g, 1g, 10g, 15g.
1-(bromomethyl)-2-(trifluoromethoxy)benzene (CAS 198649-68-2) is a chemical compound with the molecular formula C8H6BrF3O and a molecular weight of 255.03 g/mol. IUPAC name: 1-(bromomethyl)-2-(trifluoromethoxy)benzene. InChIKey: TUNSVUOTVLWNQT-UHFFFAOYSA-N.
| Molecular formula | C8H6BrF3O |
|---|---|
| Molecular weight | 255.03 g/mol |
| IUPAC name | 1-(bromomethyl)-2-(trifluoromethoxy)benzene |
| InChIKey | TUNSVUOTVLWNQT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CBr)OC(F)(F)F |
Computed by PubChem (NCBI)