CAS 888327-41-1 is the registry number for 1-Bromo-3-(2,2,2-trifluoroethoxy)benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 25g, 1g.
1-bromo-3-(2,2,2-trifluoroethoxy)benzene (CAS 888327-41-1) is a chemical compound with the molecular formula C8H6BrF3O and a molecular weight of 255.03 g/mol. IUPAC name: 1-bromo-3-(2,2,2-trifluoroethoxy)benzene. InChIKey: DMRXIXTWYWJIPR-UHFFFAOYSA-N.
| Molecular formula | C8H6BrF3O |
|---|---|
| Molecular weight | 255.03 g/mol |
| IUPAC name | 1-bromo-3-(2,2,2-trifluoroethoxy)benzene |
| InChIKey | DMRXIXTWYWJIPR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)OCC(F)(F)F |
Computed by PubChem (NCBI)