Products 1214330-94-5
CAS 1214330-94-5 appears in our catalog under these names: 2-Bromo-3-(trifluoromethyl)benzyl alcohol, 95%, (2-Bromo-3-(trifluoromethyl)phenyl)methanol, 95%, 2-BROMO-3-(TRIFLUOROMETHYL)BENZYL ALCOHOL. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
[2-bromo-3-(trifluoromethyl)phenyl]methanol (CAS 1214330-94-5) is a chemical compound with the molecular formula C8H6BrF3O and a molecular weight of 255.03 g/mol. IUPAC name: [2-bromo-3-(trifluoromethyl)phenyl]methanol. InChIKey: RXILCRCVSXPTRR-UHFFFAOYSA-N.
| Molecular formula | C8H6BrF3O |
|---|---|
| Molecular weight | 255.03 g/mol |
| IUPAC name | [2-bromo-3-(trifluoromethyl)phenyl]methanol |
| InChIKey | RXILCRCVSXPTRR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)C(F)(F)F)Br)CO |
Computed by PubChem (NCBI)