CAS 50904-38-6 appears in our catalog under these names: 1-Bromo-3-(4-fluorophenoxy)benzene 97%, 1-bromo-3-(4-fluorophenoxy)benzene, 97%, 97%, 3-Bromo-4'-fluorodiphenyl ether, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
1-bromo-3-(4-fluorophenoxy)benzene (CAS 50904-38-6) is a chemical compound with the molecular formula C12H8BrFO and a molecular weight of 267.09 g/mol. IUPAC name: 1-bromo-3-(4-fluorophenoxy)benzene. InChIKey: ADGMRCLDJLCOKF-UHFFFAOYSA-N.
| Molecular formula | C12H8BrFO |
|---|---|
| Molecular weight | 267.09 g/mol |
| IUPAC name | 1-bromo-3-(4-fluorophenoxy)benzene |
| InChIKey | ADGMRCLDJLCOKF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)OC2=CC=C(C=C2)F |
Computed by PubChem (NCBI)