CAS 1138557-58-0 appears in our catalog under these names: 1-Bromo-2-fluoro-4-phenoxybenzene 97%, 1-Bromo-2-fluoro-4-phenoxybenzene, 97%, 97%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-bromo-2-fluoro-4-phenoxybenzene (CAS 1138557-58-0) is a chemical compound with the molecular formula C12H8BrFO and a molecular weight of 267.09 g/mol. IUPAC name: 1-bromo-2-fluoro-4-phenoxybenzene. InChIKey: LCDBXDWQVNJFPO-UHFFFAOYSA-N.
| Molecular formula | C12H8BrFO |
|---|---|
| Molecular weight | 267.09 g/mol |
| IUPAC name | 1-bromo-2-fluoro-4-phenoxybenzene |
| InChIKey | LCDBXDWQVNJFPO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC(=C(C=C2)Br)F |
Computed by PubChem (NCBI)