CAS 116831-27-7 is the registry number for 4'-Bromo-2'-fluoro-[1,1'-biphenyl]-4-ol, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
4-(4-bromo-2-fluorophenyl)phenol (CAS 116831-27-7) is a chemical compound with the molecular formula C12H8BrFO and a molecular weight of 267.09 g/mol. IUPAC name: 4-(4-bromo-2-fluorophenyl)phenol. InChIKey: WOIQLQNFGBYUQN-UHFFFAOYSA-N.
| Molecular formula | C12H8BrFO |
|---|---|
| Molecular weight | 267.09 g/mol |
| IUPAC name | 4-(4-bromo-2-fluorophenyl)phenol |
| InChIKey | WOIQLQNFGBYUQN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(C=C(C=C2)Br)F)O |
Computed by PubChem (NCBI)