cas: 648906-28-9 — see every product listed under this CAS number, including other names
1-Bromo-4-(cyclopropylsulfonyl)benzene 95% (CAS 648906-28-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A179354-100mg |
| cas | 648906-28-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 125.62 Pln | |
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 565.06 Pln | |
| Ambeed | 5g | 1766.56 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A179354 |
1-bromo-4-cyclopropylsulfonylbenzene (CAS 648906-28-9) is a chemical compound with the molecular formula C9H9BrO2S and a molecular weight of 261.14 g/mol. IUPAC name: 1-bromo-4-cyclopropylsulfonylbenzene. InChIKey: YTJMDWOCBCVVGM-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO2S |
|---|---|
| Molecular weight | 261.14 g/mol |
| IUPAC name | 1-bromo-4-cyclopropylsulfonylbenzene |
| InChIKey | YTJMDWOCBCVVGM-UHFFFAOYSA-N |
| SMILES | C1CC1S(=O)(=O)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)