CAS 1824127-03-8 appears in our catalog under these names: Methyl 4-bromo-2-(methylthio)benzoate, 95%, Methyl 4-bromo-2-(methylthio)benzoate. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
Methyl 4-bromo-2-methylsulfanylbenzoate (CAS 1824127-03-8) is a chemical compound with the molecular formula C9H9BrO2S and a molecular weight of 261.14 g/mol. IUPAC name: methyl 4-bromo-2-methylsulfanylbenzoate. InChIKey: YJLVEWVNFFFEAF-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO2S |
|---|---|
| Molecular weight | 261.14 g/mol |
| IUPAC name | methyl 4-bromo-2-methylsulfanylbenzoate |
| InChIKey | YJLVEWVNFFFEAF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)Br)SC |
Computed by PubChem (NCBI)