CAS 945589-08-2 is the registry number for (E)-Ethyl3-(4-bromothiophen-2-yl)acrylate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
Ethyl (E)-3-(4-bromothiophen-2-yl)prop-2-enoate (CAS 945589-08-2) is a chemical compound with the molecular formula C9H9BrO2S and a molecular weight of 261.14 g/mol. IUPAC name: ethyl (E)-3-(4-bromothiophen-2-yl)prop-2-enoate. InChIKey: TWDQFDCXBLRQDR-ONEGZZNKSA-N.
| Molecular formula | C9H9BrO2S |
|---|---|
| Molecular weight | 261.14 g/mol |
| IUPAC name | ethyl (E)-3-(4-bromothiophen-2-yl)prop-2-enoate |
| InChIKey | TWDQFDCXBLRQDR-ONEGZZNKSA-N |
| SMILES | CCOC(=O)/C=C/C1=CC(=CS1)Br |
Computed by PubChem (NCBI)