CAS 1019108-43-0 is the registry number for Methyl 2-bromo-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-bromo-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate (CAS 1019108-43-0) is a chemical compound with the molecular formula C9H9BrO2S and a molecular weight of 261.14 g/mol. IUPAC name: methyl 2-bromo-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate. InChIKey: UCSNDBLSWWZHRN-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO2S |
|---|---|
| Molecular weight | 261.14 g/mol |
| IUPAC name | methyl 2-bromo-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate |
| InChIKey | UCSNDBLSWWZHRN-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(SC2=C1CCC2)Br |
Computed by PubChem (NCBI)