cas: 1394130-50-7 — see every product listed under this CAS number, including other names
1-Bromo-4-(difluoromethoxy)-2,5-difluorobenzene, ≥95%, ≥95% (CAS 1394130-50-7) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch132PQQ-1g |
| cas | 1394130-50-7 |
| size | 1g |
| availability | 7g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 3866.00 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
1-bromo-4-(difluoromethoxy)-2,5-difluorobenzene (CAS 1394130-50-7) is a chemical compound with the molecular formula C7H3BrF4O and a molecular weight of 259.00 g/mol. IUPAC name: 1-bromo-4-(difluoromethoxy)-2,5-difluorobenzene. InChIKey: CNWLXLSHJUDWRK-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF4O |
|---|---|
| Molecular weight | 259.00 g/mol |
| IUPAC name | 1-bromo-4-(difluoromethoxy)-2,5-difluorobenzene |
| InChIKey | CNWLXLSHJUDWRK-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)Br)F)OC(F)F |
Computed by PubChem (NCBI)