CAS 1394130-50-7 appears in our catalog under these names: 1-Bromo-4-(difluoromethoxy)-2,5-difluorobenzene, 95%, 1-Bromo-4-(difluoromethoxy)-2,5-difluorobenzene, ≥95%, ≥95%, 1-Bromo-4-(difluoromethoxy)-2,5-difluorobenzene, ≥95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg.
1-bromo-4-(difluoromethoxy)-2,5-difluorobenzene (CAS 1394130-50-7) is a chemical compound with the molecular formula C7H3BrF4O and a molecular weight of 259.00 g/mol. IUPAC name: 1-bromo-4-(difluoromethoxy)-2,5-difluorobenzene. InChIKey: CNWLXLSHJUDWRK-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF4O |
|---|---|
| Molecular weight | 259.00 g/mol |
| IUPAC name | 1-bromo-4-(difluoromethoxy)-2,5-difluorobenzene |
| InChIKey | CNWLXLSHJUDWRK-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)Br)F)OC(F)F |
Computed by PubChem (NCBI)