Products 181806-67-7
CAS 181806-67-7 appears in our catalog under these names: 5-Bromo-2-(difluoromethoxy)-1,3-difluorobenzene, 98%, 5-Bromo-2-(Difluoromethoxy)-1,3-Difluorobenzene, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 25g, 5g, 1g, 100mg, 250mg.
5-bromo-2-(difluoromethoxy)-1,3-difluorobenzene (CAS 181806-67-7) is a chemical compound with the molecular formula C7H3BrF4O and a molecular weight of 259.00 g/mol. IUPAC name: 5-bromo-2-(difluoromethoxy)-1,3-difluorobenzene. InChIKey: ZZIBINAQRAEVEO-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF4O |
|---|---|
| Molecular weight | 259.00 g/mol |
| IUPAC name | 5-bromo-2-(difluoromethoxy)-1,3-difluorobenzene |
| InChIKey | ZZIBINAQRAEVEO-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)OC(F)F)F)Br |
Computed by PubChem (NCBI)